Compound Record
| Chemical Information | |
|---|---|
| Compound Name | tetrachloroethene |
| Primary ID | RDDB00024 |
| Description | Tetrachloroethylene, also known as perchloroethylene (PCE) is a colorless liquid widely used for dry cleaning of fabrics. It has a sweet odor detectable by most people at a concentration of 1 part per million (1 ppm). Exposure to PCE increases the risk of developing Parkinson's disease ninefold. PCE is a Group 2A carcinogen and central nervous system depressant. |
| CAS Number | 127-18-4 |
| Structure |  |
| Chemical Formula | C2Cl4 |
| IUPAC name | tetrachloroethene |
| InChI Identifier | InChI=1S/C2Cl4/c3-1(4)2(5)6 |
| InChI Key | CYTYCFOTNPOANT-UHFFFAOYSA-N |
| SMILES | C(=C(Cl)Cl)(Cl)Cl |
| Average Molecular Weight | 165.8330 |
| Monoisotopic Molecular Weight | 163.875410828 |
| External Links | |
| KEGG Compound ID | C06789 |
| Pubchem Compound ID | 31373 |
| Pubchem Substance ID | Not Available |
| ChEBI ID | 17300 |
| Phenol-Explorer ID | Not Available |
| DrugBank ID | Not Available |
| HMDB ID | HMDB41980 |
Associated Proteins (14)
Accession No. WP_011460641
OG Group: 6
Organism: Desulfitobacterium hafniense Y51
Accession No. AHF10727
OG Group: 96
Organism: Dehalobacter restrictus DSM 9455